CAS 4750-57-6 is the registry number for 1-Methyl-5-nitro-1H-imidazole-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-5-nitroimidazole-2-carbaldehyde (CAS 4750-57-6) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 1-methyl-5-nitroimidazole-2-carbaldehyde. InChIKey: JLQLFVSTEDRFAD-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1-methyl-5-nitroimidazole-2-carbaldehyde |
| InChIKey | JLQLFVSTEDRFAD-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)