Products 478-35-3
CAS 478-35-3 is the registry number for Carviolin. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, Get quote.
1,3-dihydroxy-6-(hydroxymethyl)-8-methoxyanthracene-9,10-dione (CAS 478-35-3) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 1,3-dihydroxy-6-(hydroxymethyl)-8-methoxyanthracene-9,10-dione. InChIKey: XNMZBRJAWRIJII-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 1,3-dihydroxy-6-(hydroxymethyl)-8-methoxyanthracene-9,10-dione |
| InChIKey | XNMZBRJAWRIJII-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)C3=C(C2=O)C=C(C=C3O)O)CO |
Computed by PubChem (NCBI)