CAS 478-76-2 is the registry number for Norapomorphine. Offered by: Chemat Brand. Available pack sizes: on request.
(6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol (CAS 478-76-2) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol. InChIKey: MHPQCGZBAVXCGA-GFCCVEGCSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (6aR)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol |
| InChIKey | MHPQCGZBAVXCGA-GFCCVEGCSA-N |
| SMILES | C1CN[C@@H]2CC3=C(C4=CC=CC1=C24)C(=C(C=C3)O)O |
Computed by PubChem (NCBI)