CAS 478258-61-6 appears in our catalog under these names: Methyl 2-amino-4-t-butylthiazole-5-carboxylate, 96%, Methyl 2-amino-4-t-butylthiazole-5-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g.
Methyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate (CAS 478258-61-6) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: methyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate. InChIKey: HOTBDFJALOEEMH-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | methyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate |
| InChIKey | HOTBDFJALOEEMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(SC(=N1)N)C(=O)OC |
Computed by PubChem (NCBI)