Products 479198-74-8
CAS 479198-74-8 appears in our catalog under these names: tert-Butyl methyl(thiazol-2-yl)carbamate, 98%, Methylthiazol-2-ylcarbamic acid tert-butyl ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
Tert-butyl N-methyl-N-(1,3-thiazol-2-yl)carbamate (CAS 479198-74-8) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: tert-butyl N-methyl-N-(1,3-thiazol-2-yl)carbamate. InChIKey: YEFAMUXMAJVGDW-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | tert-butyl N-methyl-N-(1,3-thiazol-2-yl)carbamate |
| InChIKey | YEFAMUXMAJVGDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=NC=CS1 |
Computed by PubChem (NCBI)