Products 926246-39-1
CAS 926246-39-1 is the registry number for N-(4-Amino-2-methylphenyl)ethane-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(4-amino-2-methylphenyl)ethanesulfonamide (CAS 926246-39-1) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)ethanesulfonamide. InChIKey: MTYUBMFMURYQHK-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)ethanesulfonamide |
| InChIKey | MTYUBMFMURYQHK-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NC1=C(C=C(C=C1)N)C |
Computed by PubChem (NCBI)