CAS 71398-48-6 appears in our catalog under these names: 4-(Aminomethyl)-n,n-dimethylbenzene-1-sulfonamide hydrochloride, 95%, 4-(Aminomethyl)-N,N-dimethylbenzene-1-sulfonamide hydrochloride, 90%, 4-(Aminomethyl)-N,N-dimethylbenzene-1-sulfonamide hydrochloride, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg.
N,N-dimethyl-4-(methylamino)benzenesulfonamide (CAS 71398-48-6) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N,N-dimethyl-4-(methylamino)benzenesulfonamide. InChIKey: GZPBMGVKWGJDIF-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N,N-dimethyl-4-(methylamino)benzenesulfonamide |
| InChIKey | GZPBMGVKWGJDIF-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)