Products 4817-95-2
CAS 4817-95-2 appears in our catalog under these names: Z–Val–Phe–OMe, Z-Val-Phe-OMe. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g.
Methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate (CAS 4817-95-2) is a chemical compound with the molecular formula C23H28N2O5 and a molecular weight of 412.5 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate. InChIKey: LCLXBNDAOUUZSN-PMACEKPBSA-N.
| Molecular formula | C23H28N2O5 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoate |
| InChIKey | LCLXBNDAOUUZSN-PMACEKPBSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)