CAS 4831-14-5 is the registry number for N-Ethyl-dl-norephedrine Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
(2S)-2-(ethylamino)-1-phenylpropan-1-ol;hydrochloride (CAS 4831-14-5) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (2S)-2-(ethylamino)-1-phenylpropan-1-ol;hydrochloride. InChIKey: DHNCTQIFOGRFJF-QMOSYVFLSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (2S)-2-(ethylamino)-1-phenylpropan-1-ol;hydrochloride |
| InChIKey | DHNCTQIFOGRFJF-QMOSYVFLSA-N |
| SMILES | CCN[C@@H](C)C(C1=CC=CC=C1)O.Cl |
Computed by PubChem (NCBI)