CAS 4849-46-1 is the registry number for Neostigmine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-hydroxyphenyl)-1,1-dimethylurea (CAS 4849-46-1) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 3-(3-hydroxyphenyl)-1,1-dimethylurea. InChIKey: HQSQPMWCWCOTBH-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)-1,1-dimethylurea |
| InChIKey | HQSQPMWCWCOTBH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC(=CC=C1)O |
Computed by PubChem (NCBI)