CAS 486455-30-5 appears in our catalog under these names: 3-(4-Methylphenyl)phenol, 98%, 4'-Methyl-(1,1'-biphenyl)-3-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-methylphenyl)phenol (CAS 486455-30-5) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 3-(4-methylphenyl)phenol. InChIKey: NRRCYQZPZNDJER-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 3-(4-methylphenyl)phenol |
| InChIKey | NRRCYQZPZNDJER-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)