Products 4869-36-7
CAS 4869-36-7 is the registry number for 6-(3,4-Dimethylphenyl)-4,5-dihydropyridazin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dimethylphenyl)-4,5-dihydro-1H-pyridazin-6-one (CAS 4869-36-7) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-4,5-dihydro-1H-pyridazin-6-one. InChIKey: SQHIVFKBUUFEGN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | SQHIVFKBUUFEGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NNC(=O)CC2)C |
Computed by PubChem (NCBI)