Products 487-34-3
CAS 487-34-3 is the registry number for Inactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(3,5-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxyethyl]piperidine-2,6-dione (CAS 487-34-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 4-[2-(3,5-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxyethyl]piperidine-2,6-dione. InChIKey: GCCDDVHZHSSEMD-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 4-[2-(3,5-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxyethyl]piperidine-2,6-dione |
| InChIKey | GCCDDVHZHSSEMD-UHFFFAOYSA-N |
| SMILES | CC1CC(C(=O)C(=C1)C(CC2CC(=O)NC(=O)C2)O)C |
Computed by PubChem (NCBI)
Synonyms:
Inactone, orb3024704