CAS 487-66-1 appears in our catalog under these names: 2,5–Dihydro–4–methyl–2,5–dioxo–3–furanpropanoic Acid, 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic acid, 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic Acid, >97.0%(GC)(T), 2,5-Dihydro-4-methyl-2,5-dioxo-3-furanpropanoic Acid, 98%, 98%, 3-(4-Methyl-2,5-dioxo-2,5-dihydrofuran-3-yl)propanoic acid, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 2,5g, 5g, 100mg, 250mg, 10g, 500mg.
3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid (CAS 487-66-1) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid. InChIKey: FWBJLYXRIRBVQG-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-(4-methyl-2,5-dioxofuran-3-yl)propanoic acid |
| InChIKey | FWBJLYXRIRBVQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC1=O)CCC(=O)O |
Computed by PubChem (NCBI)