CAS 4876-16-8 appears in our catalog under these names: 4-(hydroxymethyl)quinolin-2(1H)-one, 4-(Hydroxymethyl)-2(1H)-quinolinone. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,1g, 0,25g, 0,5g, 1g.
4-(hydroxymethyl)-1H-quinolin-2-one (CAS 4876-16-8) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-(hydroxymethyl)-1H-quinolin-2-one. InChIKey: PIAAVJUTJZIVLQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-(hydroxymethyl)-1H-quinolin-2-one |
| InChIKey | PIAAVJUTJZIVLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CO |
Computed by PubChem (NCBI)