CAS 488817-09-0 is the registry number for 2-(2-Chloropyrimidin-4-yl)-2,3-dihydro-1H-isoindole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2-chloropyrimidin-4-yl)-1,3-dihydroisoindole (CAS 488817-09-0) is a chemical compound with the molecular formula C12H10ClN3 and a molecular weight of 231.68 g/mol. IUPAC name: 2-(2-chloropyrimidin-4-yl)-1,3-dihydroisoindole. InChIKey: NKGCZTWDBXFGEH-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 2-(2-chloropyrimidin-4-yl)-1,3-dihydroisoindole |
| InChIKey | NKGCZTWDBXFGEH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN1C3=NC(=NC=C3)Cl |
Computed by PubChem (NCBI)