Products 489406-95-3
CAS 489406-95-3 is the registry number for 4-Chloro-N-cyclopentyl-1-methyl-1h-pyrazole-3-carboxamide, 98%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
4-chloro-N-cyclopentyl-1-methylpyrazole-3-carboxamide (CAS 489406-95-3) is a chemical compound with the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. IUPAC name: 4-chloro-N-cyclopentyl-1-methylpyrazole-3-carboxamide. InChIKey: AEWMHZKRUKXXFH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 4-chloro-N-cyclopentyl-1-methylpyrazole-3-carboxamide |
| InChIKey | AEWMHZKRUKXXFH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)NC2CCCC2)Cl |
Computed by PubChem (NCBI)