CAS 490-89-1 appears in our catalog under these names: Noradrenaline (Norepinephrine) Impurity 17, Norepinephrine Impurity 21 (Noradrenochrome), Norepinephrine Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-hydroxy-2,3-dihydro-1H-indole-5,6-dione (CAS 490-89-1) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 3-hydroxy-2,3-dihydro-1H-indole-5,6-dione. InChIKey: LXXQZMIOKXLXPT-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 3-hydroxy-2,3-dihydro-1H-indole-5,6-dione |
| InChIKey | LXXQZMIOKXLXPT-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC(=O)C(=O)C=C2N1)O |
Computed by PubChem (NCBI)