CAS 53512-10-0 appears in our catalog under these names: 4-Hydroxy-1,5-naphthyridine-3-carboxylic acid, 95%, 4-Hydroxy-1,5-naphthyridine-3-carboxylic acid, 98+%, 1,5-Naphthyridine-3-carboxylicacid, 4-hydroxy-. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 50mg.
4-oxo-1H-1,5-naphthyridine-3-carboxylic acid (CAS 53512-10-0) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 4-oxo-1H-1,5-naphthyridine-3-carboxylic acid. InChIKey: LODIKMSUDZMCFF-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 4-oxo-1H-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | LODIKMSUDZMCFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C(=CN2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)