Products 4919-43-1
CAS 4919-43-1 appears in our catalog under these names: 1–Amino–2–naphthoic acid, 1-Amino-2-naphthoic acid, 95%, 1-Amino-2-naphthoic acid 98%, 1-Amino-2-naphthoic acid, 98%, 1-Amino-2-naphthoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100mg.
1-aminonaphthalene-2-carboxylic acid (CAS 4919-43-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-aminonaphthalene-2-carboxylic acid. InChIKey: VFFRLRQQWXGEBX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-aminonaphthalene-2-carboxylic acid |
| InChIKey | VFFRLRQQWXGEBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N)C(=O)O |
Computed by PubChem (NCBI)