Products 492-52-4
CAS 492-52-4 is the registry number for Visamminol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-hydroxy-2-(2-hydroxypropan-2-yl)-7-methyl-2,3-dihydrofuro[3,2-g]chromen-5-one (CAS 492-52-4) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: 4-hydroxy-2-(2-hydroxypropan-2-yl)-7-methyl-2,3-dihydrofuro[3,2-g]chromen-5-one. InChIKey: LJSWMDKKEBOERP-UHFFFAOYSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | 4-hydroxy-2-(2-hydroxypropan-2-yl)-7-methyl-2,3-dihydrofuro[3,2-g]chromen-5-one |
| InChIKey | LJSWMDKKEBOERP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C3=C(C=C2O1)OC(C3)C(C)(C)O)O |
Computed by PubChem (NCBI)