CAS 493028-20-9 appears in our catalog under these names: Runx1-CBFβ interaction inhibitor 1, 95+%, CBFβ Inhibitor/ 96.5% (existing batch purity), CBFβ Inhibitor, 5-Ethyl-4-(4-methoxy-phenyl)-thiazol-2-ylamine, 5-Ethyl-4-(4-methoxyphenyl)thiazol-2-yl-amine. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 250mg, 2,5g.
5-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-amine (CAS 493028-20-9) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 5-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-amine. InChIKey: QHRCVGXBBIRPTE-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 5-ethyl-4-(4-methoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | QHRCVGXBBIRPTE-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)