CAS 494777-01-4 is the registry number for 4-Chloro-3-methyl-2-phenylpyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-chloro-3-methyl-2-phenylpyridine (CAS 494777-01-4) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 4-chloro-3-methyl-2-phenylpyridine. InChIKey: XNQBJYZIWXOEFY-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 4-chloro-3-methyl-2-phenylpyridine |
| InChIKey | XNQBJYZIWXOEFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)