Products 494799-17-6
CAS 494799-17-6 appears in our catalog under these names: 3–Cyclohexyl–1H–indole–6–carboxylic acid, 3-Cyclohexyl-1H-indole-6-carboxylic acid, ≥95%, ≥95%, 3-Cyclohexyl-1H-indole-6-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
3-cyclohexyl-1H-indole-6-carboxylic acid (CAS 494799-17-6) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 3-cyclohexyl-1H-indole-6-carboxylic acid. InChIKey: OZJSQVKDKOOQIT-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3-cyclohexyl-1H-indole-6-carboxylic acid |
| InChIKey | OZJSQVKDKOOQIT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CNC3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)