CAS 496055-43-7 is the registry number for 5-Amino-1,3-dihydrobenzo(C)isothiazole 2,2-dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine (CAS 496055-43-7) is a chemical compound with the molecular formula C7H8N2O2S and a molecular weight of 184.22 g/mol. IUPAC name: 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine. InChIKey: ITXAMJIWJHTZRH-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2S |
|---|---|
| Molecular weight | 184.22 g/mol |
| IUPAC name | 2,2-dioxo-1,3-dihydro-2,1-benzothiazol-5-amine |
| InChIKey | ITXAMJIWJHTZRH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)NS1(=O)=O |
Computed by PubChem (NCBI)