CAS 49608-51-7 is the registry number for 2-(2-Hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
2-(2-hydroxyphenyl)-4,5-dihydrothiazole-4-carboxylic acid is a monocarboxylic acid consisting of 2-(2-hydroxyphenyl)-4,5-dihydrothiazole having a carboxy group at the 4-position. It is a monocarboxylic acid and an imidothioate.
Source: ChEBI
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | CECDPVOEINSAQG-UHFFFAOYSA-N |
| SMILES | C1C(N=C(S1)C2=CC=CC=C2O)C(=O)O |
Computed by PubChem (NCBI)