CAS 49638-23-5 is the registry number for Betaprodine Hydrochloride. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
[(3R,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride (CAS 49638-23-5) is a chemical compound with the molecular formula C16H24ClNO2 and a molecular weight of 297.82 g/mol. IUPAC name: [(3R,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride. InChIKey: LFLUADVCIBEPQJ-OALZAMAHSA-N.
| Molecular formula | C16H24ClNO2 |
|---|---|
| Molecular weight | 297.82 g/mol |
| IUPAC name | [(3R,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride |
| InChIKey | LFLUADVCIBEPQJ-OALZAMAHSA-N |
| SMILES | CCC(=O)O[C@@]1(CCN(C[C@H]1C)C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)