Products 561-78-4
CAS 561-78-4 appears in our catalog under these names: Alphaprodine Hydrochloride (1.0 mg/mL in Methanol), Alphaprodine Hydrochloride, >95% (HPLC), a-Prodine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 50mg, 5mg, 1mg, 2mg, 10mg, 25mg.
[(3S,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride (CAS 561-78-4) is a chemical compound with the molecular formula C16H24ClNO2 and a molecular weight of 297.82 g/mol. IUPAC name: [(3S,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride. InChIKey: LFLUADVCIBEPQJ-MELYUZJYSA-N.
| Molecular formula | C16H24ClNO2 |
|---|---|
| Molecular weight | 297.82 g/mol |
| IUPAC name | [(3S,4R)-1,3-dimethyl-4-phenylpiperidin-4-yl] propanoate;hydrochloride |
| InChIKey | LFLUADVCIBEPQJ-MELYUZJYSA-N |
| SMILES | CCC(=O)O[C@@]1(CCN(C[C@@H]1C)C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)