CAS 49642-11-7 is the registry number for (3S,4R)-4-Amino-3-hydroxy-6-methylheptanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
(3S,4R)-4-amino-3-hydroxy-6-methylheptanoic acid (CAS 49642-11-7) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (3S,4R)-4-amino-3-hydroxy-6-methylheptanoic acid. InChIKey: DFVFTMTWCUHJBL-RQJHMYQMSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (3S,4R)-4-amino-3-hydroxy-6-methylheptanoic acid |
| InChIKey | DFVFTMTWCUHJBL-RQJHMYQMSA-N |
| SMILES | CC(C)C[C@H]([C@H](CC(=O)O)O)N |
Computed by PubChem (NCBI)