CAS 49705-26-2 appears in our catalog under these names: L-Methionine-13C, L–Methionine–13C, L-Methionine-(methyl-13C), L-METHIONINE-METHYL-13C, 99 ATOM % 13C, L-Methionine-methyl-13C, 99 atom % 13C, 99 atom % 13C. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 0,25mg, 0,5mg, 2,5mg, 10mg, 100mg, 5mg, 50mg, 250mg.
(2S)-2-amino-4-(113C)methylsulfanylbutanoic acid (CAS 49705-26-2) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 150.21 g/mol. IUPAC name: (2S)-2-amino-4-(113C)methylsulfanylbutanoic acid. InChIKey: FFEARJCKVFRZRR-YWQIHCTDSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 150.21 g/mol |
| IUPAC name | (2S)-2-amino-4-(113C)methylsulfanylbutanoic acid |
| InChIKey | FFEARJCKVFRZRR-YWQIHCTDSA-N |
| SMILES | [13CH3]SCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)