CAS 497061-09-3 is the registry number for 1-benzothiazol-2-yl-3-(isopropyl)-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-(1,3-benzothiazol-2-yl)-5-propan-2-yl-4H-pyrazol-3-one (CAS 497061-09-3) is a chemical compound with the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-5-propan-2-yl-4H-pyrazol-3-one. InChIKey: HUTFECFUXOFDTB-UHFFFAOYSA-N.
| Molecular formula | C13H13N3OS |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-5-propan-2-yl-4H-pyrazol-3-one |
| InChIKey | HUTFECFUXOFDTB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=O)C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)