Products 497061-28-6
CAS 497061-28-6 is the registry number for ethyl 2-amino-7-methyl-5-oxo-4-(3-pyridyl)-4,6,7,8-tetrahydro2H-chromene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
Ethyl 2-amino-7-methyl-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate (CAS 497061-28-6) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: ethyl 2-amino-7-methyl-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate. InChIKey: VYKBVAGHTAOYHO-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | ethyl 2-amino-7-methyl-5-oxo-4-pyridin-3-yl-4,6,7,8-tetrahydrochromene-3-carboxylate |
| InChIKey | VYKBVAGHTAOYHO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=C(C1C3=CN=CC=C3)C(=O)CC(C2)C)N |
Computed by PubChem (NCBI)