CAS 497959-33-8 appears in our catalog under these names: 2-Bromo-4-(trifluoromethyl)benzyl alcohol, 98%, 2-Bromo-4-(trifluoromethyl)benzyl alcohol, 2-Bromo-4-(trifluoromethyl)benzyl alcohol, 98%, 98%, 2-Bromo-4-(trifluoromethyl)benzyl alcohol, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 2g, 15g.
[2-bromo-4-(trifluoromethyl)phenyl]methanol (CAS 497959-33-8) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: [2-bromo-4-(trifluoromethyl)phenyl]methanol. InChIKey: NKWNLTSBVALPBR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | [2-bromo-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | NKWNLTSBVALPBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)CO |
Computed by PubChem (NCBI)