CAS 49820-06-6 appears in our catalog under these names: 4,6-Dimethyl-1h-indole-2,3-dione, 95%, 4,6–Dimethylindoline–2,3–dione, 4,6-Dimethylindoline-2,3-dione 95%, 4,6-Dimethylindoline-2,3-dione, 97%, 97%, 4,6-Dimethyl-1H-indole-2,3-dione, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 50mg, 500mg.
4,6-dimethyl-1H-indole-2,3-dione (CAS 49820-06-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4,6-dimethyl-1H-indole-2,3-dione. InChIKey: SHOAYKZGNWFWSU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4,6-dimethyl-1H-indole-2,3-dione |
| InChIKey | SHOAYKZGNWFWSU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)NC(=O)C2=O)C |
Computed by PubChem (NCBI)