CAS 499197-60-3 is the registry number for 2,4-dichloro-N-(6-methoxypyridin-3-yl)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
2,4-dichloro-N-(6-methoxy-3-pyridinyl)benzamide (CAS 499197-60-3) is a chemical compound with the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.13 g/mol. IUPAC name: 2,4-dichloro-N-(6-methoxy-3-pyridinyl)benzamide. InChIKey: VOLFDVCWVGRLIR-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O2 |
|---|---|
| Molecular weight | 297.13 g/mol |
| IUPAC name | 2,4-dichloro-N-(6-methoxy-3-pyridinyl)benzamide |
| InChIKey | VOLFDVCWVGRLIR-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)