CAS 4992-63-6 appears in our catalog under these names: 1,2-Diethoxy-4-nitrobenzene, 95%, 1,2-Diethoxy-4-nitrobenzene 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
1,2-diethoxy-4-nitrobenzene (CAS 4992-63-6) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 1,2-diethoxy-4-nitrobenzene. InChIKey: DTYUTSMRCQYVNW-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1,2-diethoxy-4-nitrobenzene |
| InChIKey | DTYUTSMRCQYVNW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)