CAS 500024-27-1 appears in our catalog under these names: Methyl 2-cyano-3-methylbenzoate, 98%, Methyl 2–cyano–3–methylbenzoate, Methyl 2-cyano-3-methylbenzoate, Methyl 2-cyano-3-methylbenzoate, 98%, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
Methyl 2-cyano-3-methylbenzoate (CAS 500024-27-1) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 2-cyano-3-methylbenzoate. InChIKey: OINKWIOPYXLZJJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 2-cyano-3-methylbenzoate |
| InChIKey | OINKWIOPYXLZJJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)OC)C#N |
Computed by PubChem (NCBI)