CAS 500337-08-6 is the registry number for Dopamine Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2-(benzylamino)-1-(3,4-dihydroxyphenyl)ethanone (CAS 500337-08-6) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-(benzylamino)-1-(3,4-dihydroxyphenyl)ethanone. InChIKey: AGZSNLYYVFQQQA-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-(benzylamino)-1-(3,4-dihydroxyphenyl)ethanone |
| InChIKey | AGZSNLYYVFQQQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(=O)C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)