CAS 5004-88-6 appears in our catalog under these names: 2-Amino-4,5-dimethoxybenzamide, 95%, 2-Amino-4,5-dimethoxybenzamide, 2-Amino-4,5-dimethoxybenzamide 95%, 2-Amino-4,5-dimethoxybenzamide, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 250mg, 500mg.
2-amino-4,5-dimethoxybenzamide (CAS 5004-88-6) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 2-amino-4,5-dimethoxybenzamide. InChIKey: RLWBNRZPIQCPFT-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-amino-4,5-dimethoxybenzamide |
| InChIKey | RLWBNRZPIQCPFT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)N)N)OC |
Computed by PubChem (NCBI)