Products 500696-01-5
CAS 500696-01-5 appears in our catalog under these names: amino(5-bromo-2-methoxyphenyl)acetic acid, Amino(5-bromo-2-methoxyphenyl)acetic acid, 95%, 2–Amino–2–(5–bromo–2–methoxyphenyl)acetic acid. Offered by: Biosynth, Combi-blocks, GLPBio. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2-amino-2-(5-bromo-2-methoxyphenyl)acetic acid (CAS 500696-01-5) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: 2-amino-2-(5-bromo-2-methoxyphenyl)acetic acid. InChIKey: GCRUCIXWROVKQR-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 2-amino-2-(5-bromo-2-methoxyphenyl)acetic acid |
| InChIKey | GCRUCIXWROVKQR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)C(C(=O)O)N |
Computed by PubChem (NCBI)