CAS 500698-46-4 appears in our catalog under these names: 4,5-Dimethoxy-2-(trifluoromethyl)aniline, 95%, 4,5-Dimethoxy-2-(trifluoromethyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,5-dimethoxy-2-(trifluoromethyl)aniline (CAS 500698-46-4) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 4,5-dimethoxy-2-(trifluoromethyl)aniline. InChIKey: RVFJSOZGQWYDAF-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 4,5-dimethoxy-2-(trifluoromethyl)aniline |
| InChIKey | RVFJSOZGQWYDAF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(F)(F)F)N)OC |
Computed by PubChem (NCBI)