CAS 5010-53-7 appears in our catalog under these names: 5-(Benzyloxy)-2-methyl-1-benzofuran-3-carboxylic acid, 95%, 5-(Benzyloxy)-2-methylbenzofuran-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylic acid (CAS 5010-53-7) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylic acid. InChIKey: YYQFBUCGMUABMK-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-methyl-5-phenylmethoxy-1-benzofuran-3-carboxylic acid |
| InChIKey | YYQFBUCGMUABMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C=CC(=C2)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)