Products 501431-08-9
CAS 501431-08-9 is the registry number for Racemic-(1S,3S,4R,6S)-2-Tert-Butyl 3-Ethyl 6-Hydroxy-2-Azabicyclo[2.2.1]Heptane-2,3-Dicarboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-O-tert-butyl 3-O-ethyl (1S,3S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (CAS 501431-08-9) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1S,3S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate. InChIKey: ZSZLTQSQRKYFTJ-RCWTZXSCSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4R,6S)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| InChIKey | ZSZLTQSQRKYFTJ-RCWTZXSCSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@H](N1C(=O)OC(C)(C)C)[C@H](C2)O |
Computed by PubChem (NCBI)