CAS 5025-12-7 appears in our catalog under these names: Emodin Impurity 17, 2-Hydroxy-1-methyl-9,10-anthracenedione, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxy-1-methylanthracene-9,10-dione (CAS 5025-12-7) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 2-hydroxy-1-methylanthracene-9,10-dione. InChIKey: GKYPACIJAKRPRI-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-hydroxy-1-methylanthracene-9,10-dione |
| InChIKey | GKYPACIJAKRPRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)