Products 503087-17-0

CAS 503087-17-0 is the registry number for Ethyl 3-amino-4-cyano-5-(ethylamino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-4-cyano-5-(ethylamino)thiophene-2-carboxylate (CAS 503087-17-0) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. IUPAC name: ethyl 3-amino-4-cyano-5-(ethylamino)thiophene-2-carboxylate. InChIKey: HMIQCJAVDMBMET-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N3O2S
Molecular weight239.30 g/mol
IUPAC nameethyl 3-amino-4-cyano-5-(ethylamino)thiophene-2-carboxylate
InChIKeyHMIQCJAVDMBMET-UHFFFAOYSA-N
SMILESCCNC1=C(C(=C(S1)C(=O)OCC)N)C#N

Computed by PubChem (NCBI)