Products 503165-95-5
CAS 503165-95-5 is the registry number for 1-(tert-Butyl) 3-methyl (3S,4S)-4-(((benzyloxy)carbonyl)amino)pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-O-tert-butyl 3-O-methyl (3S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-1,3-dicarboxylate (CAS 503165-95-5) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-1,3-dicarboxylate. InChIKey: XSYOYZIMHTYUMP-LSDHHAIUSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-1,3-dicarboxylate |
| InChIKey | XSYOYZIMHTYUMP-LSDHHAIUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)