Products 314741-38-3
CAS 314741-38-3 appears in our catalog under these names: (S)-N-1-Boc-4-cbz-2-piperazinecarboxylic acid methyl ester, 95%, 1-Benzyl 4-(tert-butyl) 2-methyl (S)-piperazine-1,2,4-tricarboxylate, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, on request.
1-O-benzyl 4-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate (CAS 314741-38-3) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate. InChIKey: FUMOVDZJNXKHJM-HNNXBMFYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate |
| InChIKey | FUMOVDZJNXKHJM-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)C(=O)OC)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)