CAS 126937-42-6 appears in our catalog under these names: 4-N-Boc-1-n-cbz-piperazine-2-carboxylic acid methyl ester, 97%, Methyl 4-Boc-1-Cbz-2-piperazinecarboxylate 97%, Methyl 4-Boc-1-Cbz-2-piperazinecarboxylate, 96%, 96%, METHYL 4-N-BOC-1-N-CBZ-2-PIPERAZINE CARBOXYLATE, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg, 500mg.
1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate (CAS 126937-42-6) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate. InChIKey: FUMOVDZJNXKHJM-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate |
| InChIKey | FUMOVDZJNXKHJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)OC)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)