CAS 129799-14-0 appears in our catalog under these names: 4-Benzyl 1-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate, 95%, 4–benzyl 1–tert–butyl 2–methyl piperazine–1,2,4–tricarboxylate, 4-Benzyl 1-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate 95%, 4-Benzyl 1-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-O-benzyl 1-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate (CAS 129799-14-0) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate. InChIKey: JHEYLNAAOWKKBQ-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate |
| InChIKey | JHEYLNAAOWKKBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1C(=O)OC)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)