CAS 87981-04-2 appears in our catalog under these names: Maleimide-(CH2)10-COONHS, 98%, Maleimide–C10–NHS ester, Maleimide-C10-NHS ester 98%, Maleimide-(CH2)10-COONHS, 98%, 98%, Maleimide-C10-NHS ester, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 250 mg, 1 g, 5 g, 100 mg.
(2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate (CAS 87981-04-2) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate. InChIKey: SGNVTRHWJGTNKV-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| InChIKey | SGNVTRHWJGTNKV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)